C21H24N6O — CID 53181789
1-(4-methylphenyl)-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea (PubChem CID 53181789) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 53181789 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(4-methylphenyl)-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea |
| SMILES | Cc1ccc(NC(=O)NC2CCCN(c3cc(-c4ccncc4)[nH]n3)C2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-15-4-6-17(7-5-15)23-21(28)24-18-3-2-12-27(14-18)20-13-19(25-26-20)16-8-10-22-11-9-16/h4-11,13,18H,2-3,12,14H2,1H3,(H,25,26)(H2,23,24,28) |
| InChIKey | FXZWFFFBVDQKRH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |