C20H22N6O — CID 53181782
1-phenyl-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea (PubChem CID 53181782) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-phenyl-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea.
| Compound Name | 1-phenyl-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 53181782 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-phenyl-3-[1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]urea |
| SMILES | O=C(Nc1ccccc1)NC1CCCN(c2cc(-c3ccncc3)[nH]n2)C1 |
| InChI | InChI=1S/C20H22N6O/c27-20(22-16-5-2-1-3-6-16)23-17-7-4-12-26(14-17)19-13-18(24-25-19)15-8-10-21-11-9-15/h1-3,5-6,8-11,13,17H,4,7,12,14H2,(H,24,25)(H2,22,23,27) |
| InChIKey | ATSFMJBJUBAHGN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |