C15H19N5O2S — CID 128985624
1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-thiophen-3-ylurea (PubChem CID 128985624) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-thiophen-3-ylurea.
| Compound Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 128985624 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-thiophen-3-ylurea |
| SMILES | Cn1ccnc(N2CCC(NC(=O)Nc3ccsc3)CC2)c1=O |
| InChI | InChI=1S/C15H19N5O2S/c1-19-8-5-16-13(14(19)21)20-6-2-11(3-7-20)17-15(22)18-12-4-9-23-10-12/h4-5,8-11H,2-3,6-7H2,1H3,(H2,17,18,22) |
| InChIKey | PZIVYUUUKUFSOX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |