C16H20N6O2 — CID 128965407
1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-pyridin-4-ylurea (PubChem CID 128965407) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-pyridin-4-ylurea.
| Compound Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 128965407 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-pyridin-4-ylurea |
| SMILES | Cn1ccnc(N2CCCC(NC(=O)Nc3ccncc3)C2)c1=O |
| InChI | InChI=1S/C16H20N6O2/c1-21-10-8-18-14(15(21)23)22-9-2-3-13(11-22)20-16(24)19-12-4-6-17-7-5-12/h4-8,10,13H,2-3,9,11H2,1H3,(H2,17,19,20,24) |
| InChIKey | GEVBBCGRIOIDDB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |