C16H25N5O3 — CID 128990786
4-methyl-N-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]morpholine-2-carboxamide (PubChem CID 128990786) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-methyl-N-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]morpholine-2-carboxamide.
| Compound Name | 4-methyl-N-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 128990786 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-methyl-N-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]morpholine-2-carboxamide |
| SMILES | CN1CCOC(C(=O)NC2CCCN(c3nccn(C)c3=O)C2)C1 |
| InChI | InChI=1S/C16H25N5O3/c1-19-8-9-24-13(11-19)15(22)18-12-4-3-6-21(10-12)14-16(23)20(2)7-5-17-14/h5,7,12-13H,3-4,6,8-11H2,1-2H3,(H,18,22) |
| InChIKey | NWCPJFYPZMVDJX-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |