C17H28N4O2 — CID 128992835
3-[3-[(4-methoxycyclohexyl)amino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 128992835) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[3-[(4-methoxycyclohexyl)amino]piperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[3-[(4-methoxycyclohexyl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 128992835 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-[3-[(4-methoxycyclohexyl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | COC1CCC(NC2CCCN(c3nccn(C)c3=O)C2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-20-11-9-18-16(17(20)22)21-10-3-4-14(12-21)19-13-5-7-15(23-2)8-6-13/h9,11,13-15,19H,3-8,10,12H2,1-2H3 |
| InChIKey | VYRQLMIXRNCPQX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |