C16H21N5O — CID 136542354
1-methyl-3-[3-[(6-methyl-2-pyridinyl)amino]piperidin-1-yl]pyrazin-2-one (PubChem CID 136542354) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-methyl-3-[3-[(6-methyl-2-pyridinyl)amino]piperidin-1-yl]pyrazin-2-one.
| Compound Name | 1-methyl-3-[3-[(6-methyl-2-pyridinyl)amino]piperidin-1-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 136542354 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-methyl-3-[3-[(6-methyl-2-pyridinyl)amino]piperidin-1-yl]pyrazin-2-one |
| SMILES | Cc1cccc(NC2CCCN(c3nccn(C)c3=O)C2)n1 |
| InChI | InChI=1S/C16H21N5O/c1-12-5-3-7-14(18-12)19-13-6-4-9-21(11-13)15-16(22)20(2)10-8-17-15/h3,5,7-8,10,13H,4,6,9,11H2,1-2H3,(H,18,19) |
| InChIKey | VKLBXBNNPQMOFT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |