C22H30N4O — CID 129474978
1-methyl-3-[(3R)-3-[(4-phenylcyclohexyl)amino]piperidin-1-yl]pyrazin-2-one (PubChem CID 129474978) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-methyl-3-[(3R)-3-[(4-phenylcyclohexyl)amino]piperidin-1-yl]pyrazin-2-one.
| Compound Name | 1-methyl-3-[(3R)-3-[(4-phenylcyclohexyl)amino]piperidin-1-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 129474978 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-methyl-3-[(3R)-3-[(4-phenylcyclohexyl)amino]piperidin-1-yl]pyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC[C@@H](NC3CCC(c4ccccc4)CC3)C2)c1=O |
| InChI | InChI=1S/C22H30N4O/c1-25-15-13-23-21(22(25)27)26-14-5-8-20(16-26)24-19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-4,6-7,13,15,18-20,24H,5,8-12,14,16H2,1H3/t18?,19?,20-/m1/s1 |
| InChIKey | PPKNPSYOJJDEOC-SOAGJPPSSA-N |
| XLogP | 3.07 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |