C17H24N4O2 — CID 129343468
3-[(3S)-3-[(5-ethylfuran-2-yl)methylamino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 129343468) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-[(3S)-3-[(5-ethylfuran-2-yl)methylamino]piperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[(3S)-3-[(5-ethylfuran-2-yl)methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 129343468 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-[(3S)-3-[(5-ethylfuran-2-yl)methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | CCc1ccc(CN[C@H]2CCCN(c3nccn(C)c3=O)C2)o1 |
| InChI | InChI=1S/C17H24N4O2/c1-3-14-6-7-15(23-14)11-19-13-5-4-9-21(12-13)16-17(22)20(2)10-8-18-16/h6-8,10,13,19H,3-5,9,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | WUQXWDWXOAYJJY-ZDUSSCGKSA-N |
| XLogP | 1.69 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |