C19H30N4O — CID 129474458
3-[(3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 129474458) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is 3-[(3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[(3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 129474458 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 3-[(3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN[C@H]1CCCN(c2nccn(C)c2=O)C1 |
| InChI | InChI=1S/C19H30N4O/c1-14-6-4-7-15(2)17(14)12-21-16-8-5-10-23(13-16)18-19(24)22(3)11-9-20-18/h6,9,11,15-17,21H,4-5,7-8,10,12-13H2,1-3H3/t15-,16-,17+/m0/s1 |
| InChIKey | MXUIKLMPSCUHTK-YESZJQIVSA-N |
| XLogP | 2.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|