C16H25N5O2S — CID 129332840
1-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-[[(2S)-thiolan-2-yl]methyl]urea (PubChem CID 129332840) has the molecular formula C16H25N5O2S and a molecular weight of 351.48 g/mol. Its IUPAC name is 1-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-[[(2S)-thiolan-2-yl]methyl]urea.
| Compound Name | 1-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-[[(2S)-thiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 129332840 |
| Molecular Formula | C16H25N5O2S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]-3-[[(2S)-thiolan-2-yl]methyl]urea |
| SMILES | Cn1ccnc(N2CCC[C@H](NC(=O)NC[C@@H]3CCCS3)C2)c1=O |
| InChI | InChI=1S/C16H25N5O2S/c1-20-8-6-17-14(15(20)22)21-7-2-4-12(11-21)19-16(23)18-10-13-5-3-9-24-13/h6,8,12-13H,2-5,7,9-11H2,1H3,(H2,18,19,23)/t12-,13-/m0/s1 |
| InChIKey | DVMHYTQNJDHTPR-STQMWFEESA-N |
| XLogP | 0.94 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |