C15H25N5O2S — CID 129333627
1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-[(2S)-2-methylsulfanylpropyl]urea (PubChem CID 129333627) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-[(2S)-2-methylsulfanylpropyl]urea.
| Compound Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-[(2S)-2-methylsulfanylpropyl]urea |
|---|---|
| PubChem CID | 129333627 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]-3-[(2S)-2-methylsulfanylpropyl]urea |
| SMILES | CS[C@@H](C)CNC(=O)NC1CCN(c2nccn(C)c2=O)CC1 |
| InChI | InChI=1S/C15H25N5O2S/c1-11(23-3)10-17-15(22)18-12-4-7-20(8-5-12)13-14(21)19(2)9-6-16-13/h6,9,11-12H,4-5,7-8,10H2,1-3H3,(H2,17,18,22)/t11-/m0/s1 |
| InChIKey | FXXGFYIXANBCED-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |