C16H21N5O3 — CID 128975594
1-(furan-2-ylmethyl)-3-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]urea (PubChem CID 128975594) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 128975594 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[1-(4-methyl-3-oxopyrazin-2-yl)piperidin-4-yl]urea |
| SMILES | Cn1ccnc(N2CCC(NC(=O)NCc3ccco3)CC2)c1=O |
| InChI | InChI=1S/C16H21N5O3/c1-20-9-6-17-14(15(20)22)21-7-4-12(5-8-21)19-16(23)18-11-13-3-2-10-24-13/h2-3,6,9-10,12H,4-5,7-8,11H2,1H3,(H2,18,19,23) |
| InChIKey | KRIVQNSSRSHSGV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |