C24H23N5OS — CID 60570235
1-phenyl-3-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]urea (PubChem CID 60570235) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 1-phenyl-3-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]urea.
| Compound Name | 1-phenyl-3-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 60570235 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-phenyl-3-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccccc1)NC1CCN(c2nc(-c3ccsc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H23N5OS/c30-24(25-18-6-2-1-3-7-18)26-19-10-13-29(14-11-19)23-20-8-4-5-9-21(20)27-22(28-23)17-12-15-31-16-17/h1-9,12,15-16,19H,10-11,13-14H2,(H2,25,26,30) |
| InChIKey | FYYPVWGOLZZJMU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |