C24H28N4OS — CID 24508180
azepan-1-yl-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]methanone (PubChem CID 24508180) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is azepan-1-yl-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 24508180 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | azepan-1-yl-[1-(2-thiophen-3-ylquinazolin-4-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2nc(-c3ccsc3)nc3ccccc23)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C24H28N4OS/c29-24(28-12-5-1-2-6-13-28)18-9-14-27(15-10-18)23-20-7-3-4-8-21(20)25-22(26-23)19-11-16-30-17-19/h3-4,7-8,11,16-18H,1-2,5-6,9-10,12-15H2 |
| InChIKey | AMTPVSNLLAOCPX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |