C22H23N5S — CID 133280022
4-[4-(1-ethylpyrazol-4-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline (PubChem CID 133280022) has the molecular formula C22H23N5S and a molecular weight of 389.53 g/mol. Its IUPAC name is 4-[4-(1-ethylpyrazol-4-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline.
| Compound Name | 4-[4-(1-ethylpyrazol-4-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline |
|---|---|
| PubChem CID | 133280022 |
| Molecular Formula | C22H23N5S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-[4-(1-ethylpyrazol-4-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline |
| SMILES | CCn1cc(C2CCN(c3nc(-c4ccsc4)nc4ccccc34)CC2)cn1 |
| InChI | InChI=1S/C22H23N5S/c1-2-27-14-18(13-23-27)16-7-10-26(11-8-16)22-19-5-3-4-6-20(19)24-21(25-22)17-9-12-28-15-17/h3-6,9,12-16H,2,7-8,10-11H2,1H3 |
| InChIKey | LWPQZEPDQSTKNK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |