C20H17N3OS2 — CID 133363520
2-thiophen-2-yl-4-(2-thiophen-3-ylquinazolin-4-yl)morpholine (PubChem CID 133363520) has the molecular formula C20H17N3OS2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-thiophen-2-yl-4-(2-thiophen-3-ylquinazolin-4-yl)morpholine.
| Compound Name | 2-thiophen-2-yl-4-(2-thiophen-3-ylquinazolin-4-yl)morpholine |
|---|---|
| PubChem CID | 133363520 |
| Molecular Formula | C20H17N3OS2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-thiophen-2-yl-4-(2-thiophen-3-ylquinazolin-4-yl)morpholine |
| SMILES | c1csc(C2CN(c3nc(-c4ccsc4)nc4ccccc34)CCO2)c1 |
| InChI | InChI=1S/C20H17N3OS2/c1-2-5-16-15(4-1)20(22-19(21-16)14-7-11-25-13-14)23-8-9-24-17(12-23)18-6-3-10-26-18/h1-7,10-11,13,17H,8-9,12H2 |
| InChIKey | UJZORKAJMKEHHT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |