C21H24N4OS — CID 133335933
4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-thiophen-3-ylquinazoline (PubChem CID 133335933) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-thiophen-3-ylquinazoline.
| Compound Name | 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-thiophen-3-ylquinazoline |
|---|---|
| PubChem CID | 133335933 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-thiophen-3-ylquinazoline |
| SMILES | c1ccc2c(N3CCN(CC4CCOC4)CC3)nc(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C21H24N4OS/c1-2-4-19-18(3-1)21(23-20(22-19)17-6-12-27-15-17)25-9-7-24(8-10-25)13-16-5-11-26-14-16/h1-4,6,12,15-16H,5,7-11,13-14H2 |
| InChIKey | VGFXRAGKMATWIO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |