C21H20N4S2 — CID 55377922
2-thiophen-3-yl-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]quinazoline (PubChem CID 55377922) has the molecular formula C21H20N4S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-thiophen-3-yl-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]quinazoline.
| Compound Name | 2-thiophen-3-yl-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 55377922 |
| Molecular Formula | C21H20N4S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-thiophen-3-yl-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]quinazoline |
| SMILES | c1csc(CN2CCN(c3nc(-c4ccsc4)nc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C21H20N4S2/c1-2-6-19-18(5-1)21(23-20(22-19)16-7-13-26-15-16)25-10-8-24(9-11-25)14-17-4-3-12-27-17/h1-7,12-13,15H,8-11,14H2 |
| InChIKey | KSLJHQKGOAZWPX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |