C18H23N5O — CID 91648209
1-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-3-phenylurea (PubChem CID 91648209) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 91648209 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-3-phenylurea |
| SMILES | Cc1cnc(C)c(N2CCC(NC(=O)Nc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H23N5O/c1-13-12-19-14(2)17(20-13)23-10-8-16(9-11-23)22-18(24)21-15-6-4-3-5-7-15/h3-7,12,16H,8-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | INOXCYZCBNUGSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |