C18H21N5O2 — CID 133468526
4-[4-(phenylcarbamoylamino)piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 133468526) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[4-(phenylcarbamoylamino)piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 4-[4-(phenylcarbamoylamino)piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133468526 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[4-(phenylcarbamoylamino)piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1N1CCC(NC(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H21N5O2/c19-17(24)15-12-20-9-6-16(15)23-10-7-14(8-11-23)22-18(25)21-13-4-2-1-3-5-13/h1-6,9,12,14H,7-8,10-11H2,(H2,19,24)(H2,21,22,25) |
| InChIKey | ZYZGPSAZTLGQHF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |