C26H27FN4O2 — CID 42848467
N-[(3-fluorophenyl)methyl]-2-[4-(phenylcarbamoylamino)piperidin-1-yl]benzamide (PubChem CID 42848467) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[4-(phenylcarbamoylamino)piperidin-1-yl]benzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[4-(phenylcarbamoylamino)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42848467 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[4-(phenylcarbamoylamino)piperidin-1-yl]benzamide |
| SMILES | O=C(Nc1ccccc1)NC1CCN(c2ccccc2C(=O)NCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C26H27FN4O2/c27-20-8-6-7-19(17-20)18-28-25(32)23-11-4-5-12-24(23)31-15-13-22(14-16-31)30-26(33)29-21-9-2-1-3-10-21/h1-12,17,22H,13-16,18H2,(H,28,32)(H2,29,30,33) |
| InChIKey | IBZMYXYNWISKDG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |