C24H31FN4O2 — CID 42848136
N-[3-(dimethylamino)propyl]-2-[4-[(3-fluorobenzoyl)amino]piperidin-1-yl]benzamide (PubChem CID 42848136) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[4-[(3-fluorobenzoyl)amino]piperidin-1-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[4-[(3-fluorobenzoyl)amino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42848136 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[4-[(3-fluorobenzoyl)amino]piperidin-1-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccccc1N1CCC(NC(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H31FN4O2/c1-28(2)14-6-13-26-24(31)21-9-3-4-10-22(21)29-15-11-20(12-16-29)27-23(30)18-7-5-8-19(25)17-18/h3-5,7-10,17,20H,6,11-16H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | VRTAKVDFGSBJBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|