C26H25F2N3O2 — CID 42848178
2-[4-[(4-fluorobenzoyl)amino]piperidin-1-yl]-N-[(3-fluorophenyl)methyl]benzamide (PubChem CID 42848178) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-[4-[(4-fluorobenzoyl)amino]piperidin-1-yl]-N-[(3-fluorophenyl)methyl]benzamide.
| Compound Name | 2-[4-[(4-fluorobenzoyl)amino]piperidin-1-yl]-N-[(3-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42848178 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[4-[(4-fluorobenzoyl)amino]piperidin-1-yl]-N-[(3-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)NCc2cccc(F)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H25F2N3O2/c27-20-10-8-19(9-11-20)25(32)30-22-12-14-31(15-13-22)24-7-2-1-6-23(24)26(33)29-17-18-4-3-5-21(28)16-18/h1-11,16,22H,12-15,17H2,(H,29,33)(H,30,32) |
| InChIKey | ATIJLRPZLWLSLJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |