C27H29FN4O2 — CID 46038594
N-[(3-fluorophenyl)methyl]-2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]benzamide (PubChem CID 46038594) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]benzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 46038594 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)NC2CCN(c3ccccc3C(=O)NCc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H29FN4O2/c1-19-9-11-22(12-10-19)30-27(34)31-23-13-15-32(16-14-23)25-8-3-2-7-24(25)26(33)29-18-20-5-4-6-21(28)17-20/h2-12,17,23H,13-16,18H2,1H3,(H,29,33)(H2,30,31,34) |
| InChIKey | MAWCBBORNAXYPY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |