C25H32N4O3 — CID 46038584
2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 46038584) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46038584 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[4-[(4-methylphenyl)carbamoylamino]piperidin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)NC2CCN(c3ccccc3C(=O)NCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-18-8-10-19(11-9-18)27-25(31)28-20-12-14-29(15-13-20)23-7-3-2-6-22(23)24(30)26-17-21-5-4-16-32-21/h2-3,6-11,20-21H,4-5,12-17H2,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | SASMMTARBLGBPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |