C22H27N3O3S — CID 93324114
N-[1-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 93324114) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[1-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 93324114 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[1-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)NC[C@H]2CCCO2)CC1)c1cccs1 |
| InChI | InChI=1S/C22H27N3O3S/c26-21(23-15-17-5-3-13-28-17)18-6-1-2-7-19(18)25-11-9-16(10-12-25)24-22(27)20-8-4-14-29-20/h1-2,4,6-8,14,16-17H,3,5,9-13,15H2,(H,23,26)(H,24,27)/t17-/m1/s1 |
| InChIKey | IIFSXXLKHSKFDC-QGZVFWFLSA-N |
| XLogP | 3.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |