C22H29N3O2S — CID 93324323
N-[1-[2-[[(2S)-2-methylbutyl]carbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 93324323) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[1-[2-[[(2S)-2-methylbutyl]carbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[[(2S)-2-methylbutyl]carbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 93324323 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[1-[2-[[(2S)-2-methylbutyl]carbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | CC[C@H](C)CNC(=O)c1ccccc1N1CCC(NC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-3-16(2)15-23-21(26)18-7-4-5-8-19(18)25-12-10-17(11-13-25)24-22(27)20-9-6-14-28-20/h4-9,14,16-17H,3,10-13,15H2,1-2H3,(H,23,26)(H,24,27)/t16-/m0/s1 |
| InChIKey | YBNBRRGVYBHEMD-INIZCTEOSA-N |
| XLogP | 3.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |