C30H29N3O2S — CID 46037924
N-[1-[2-[(4-phenylphenyl)methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 46037924) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[1-[2-[(4-phenylphenyl)methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[(4-phenylphenyl)methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46037924 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[1-[2-[(4-phenylphenyl)methylcarbamoyl]phenyl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)NCc2ccc(-c3ccccc3)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C30H29N3O2S/c34-29(31-21-22-12-14-24(15-13-22)23-7-2-1-3-8-23)26-9-4-5-10-27(26)33-18-16-25(17-19-33)32-30(35)28-11-6-20-36-28/h1-15,20,25H,16-19,21H2,(H,31,34)(H,32,35) |
| InChIKey | XVXARFUJBKQBEJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |