C28H28FN3O2 — CID 75140862
N-[(4-fluorophenyl)methyl]-2-[4-(3-phenylprop-2-enoylamino)piperidin-1-yl]benzamide (PubChem CID 75140862) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(3-phenylprop-2-enoylamino)piperidin-1-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-phenylprop-2-enoylamino)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 75140862 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(3-phenylprop-2-enoylamino)piperidin-1-yl]benzamide |
| SMILES | O=C(C=Cc1ccccc1)NC1CCN(c2ccccc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H28FN3O2/c29-23-13-10-22(11-14-23)20-30-28(34)25-8-4-5-9-26(25)32-18-16-24(17-19-32)31-27(33)15-12-21-6-2-1-3-7-21/h1-15,24H,16-20H2,(H,30,34)(H,31,33) |
| InChIKey | DQDJDLPDEOYARV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|