C27H33N3O2 — CID 42682841
(E)-N-[1-[2-(4-methylpiperidine-1-carbonyl)phenyl]piperidin-4-yl]-3-phenylprop-2-enamide (PubChem CID 42682841) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is (E)-N-[1-[2-(4-methylpiperidine-1-carbonyl)phenyl]piperidin-4-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[2-(4-methylpiperidine-1-carbonyl)phenyl]piperidin-4-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42682841 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (E)-N-[1-[2-(4-methylpiperidine-1-carbonyl)phenyl]piperidin-4-yl]-3-phenylprop-2-enamide |
| SMILES | CC1CCN(C(=O)c2ccccc2N2CCC(NC(=O)/C=C/c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-21-13-17-30(18-14-21)27(32)24-9-5-6-10-25(24)29-19-15-23(16-20-29)28-26(31)12-11-22-7-3-2-4-8-22/h2-12,21,23H,13-20H2,1H3,(H,28,31)/b12-11+ |
| InChIKey | KBHNOTGKKQNFTM-VAWYXSNFSA-N |
| XLogP | 4.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|