C26H27FN4O3 — CID 46348983
N-[(3-fluorophenyl)methyl]-3-[(4-methylphenyl)carbamoylamino]-4-morpholin-4-ylbenzamide (PubChem CID 46348983) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-[(4-methylphenyl)carbamoylamino]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-[(4-methylphenyl)carbamoylamino]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 46348983 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-[(4-methylphenyl)carbamoylamino]-4-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(=O)NCc3cccc(F)c3)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H27FN4O3/c1-18-5-8-22(9-6-18)29-26(33)30-23-16-20(7-10-24(23)31-11-13-34-14-12-31)25(32)28-17-19-3-2-4-21(27)15-19/h2-10,15-16H,11-14,17H2,1H3,(H,28,32)(H2,29,30,33) |
| InChIKey | UENWPSQEQJCCPG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |