C33H33N3O3 — CID 67373018
4-methyl-3-[4-[(3-methylphenyl)methylcarbamoyl]phenyl]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 67373018) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-methyl-3-[4-[(3-methylphenyl)methylcarbamoyl]phenyl]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-methyl-3-[4-[(3-methylphenyl)methylcarbamoyl]phenyl]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 67373018 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 4-methyl-3-[4-[(3-methylphenyl)methylcarbamoyl]phenyl]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1cccc(CNC(=O)c2ccc(-c3cc(C(=O)Nc4ccc(N5CCOCC5)cc4)ccc3C)cc2)c1 |
| InChI | InChI=1S/C33H33N3O3/c1-23-4-3-5-25(20-23)22-34-32(37)27-10-8-26(9-11-27)31-21-28(7-6-24(31)2)33(38)35-29-12-14-30(15-13-29)36-16-18-39-19-17-36/h3-15,20-21H,16-19,22H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | HPERBMULKSRCMB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|