C29H36N4O2 — CID 67374524
3-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]-4-methyl-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 67374524) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]-4-methyl-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]-4-methyl-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 67374524 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]-4-methyl-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)cc1-c1ccc(CNCCN(C)C)cc1 |
| InChI | InChI=1S/C29H36N4O2/c1-22-4-7-25(20-28(22)24-8-5-23(6-9-24)21-30-14-15-32(2)3)29(34)31-26-10-12-27(13-11-26)33-16-18-35-19-17-33/h4-13,20,30H,14-19,21H2,1-3H3,(H,31,34) |
| InChIKey | ICOFECXPHPQAFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|