C18H20FN3O3 — CID 67287131
N-[(3-fluorophenyl)methyl]-4-methyl-6-morpholin-4-yl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 67287131) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-methyl-6-morpholin-4-yl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-methyl-6-morpholin-4-yl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67287131 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-methyl-6-morpholin-4-yl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)[nH]c(=O)c1C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C18H20FN3O3/c1-12-9-15(22-5-7-25-8-6-22)21-18(24)16(12)17(23)20-11-13-3-2-4-14(19)10-13/h2-4,9-10H,5-8,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | RQHMRUSMKSMBOD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |