C28H32N4O2 — CID 20964867
N-[(4-methylphenyl)methyl]-3-(2-phenylethylcarbamoylamino)-4-pyrrolidin-1-ylbenzamide (PubChem CID 20964867) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-3-(2-phenylethylcarbamoylamino)-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(4-methylphenyl)methyl]-3-(2-phenylethylcarbamoylamino)-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 20964867 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-3-(2-phenylethylcarbamoylamino)-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(N3CCCC3)c(NC(=O)NCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-21-9-11-23(12-10-21)20-30-27(33)24-13-14-26(32-17-5-6-18-32)25(19-24)31-28(34)29-16-15-22-7-3-2-4-8-22/h2-4,7-14,19H,5-6,15-18,20H2,1H3,(H,30,33)(H2,29,31,34) |
| InChIKey | YTGSJEQEWHZTIG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |