C22H25N5OS — CID 60570046
1-[1-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-4-yl]-3-phenylurea (PubChem CID 60570046) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-[1-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 60570046 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[1-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-4-yl]-3-phenylurea |
| SMILES | Cc1nc(N2CCC(NC(=O)Nc3ccccc3)CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C22H25N5OS/c1-14-23-20(19-17-8-5-9-18(17)29-21(19)24-14)27-12-10-16(11-13-27)26-22(28)25-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-13H2,1H3,(H2,25,26,28) |
| InChIKey | LSTHUVZFBDWYGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |