C20H29N5OS — CID 166603690
1,1,3-trimethyl-3-[1-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]urea (PubChem CID 166603690) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[1-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]urea.
| Compound Name | 1,1,3-trimethyl-3-[1-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 166603690 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1,1,3-trimethyl-3-[1-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl]urea |
| SMILES | Cc1nc(N2CCC(N(C)C(=O)N(C)C)CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C20H29N5OS/c1-13-21-18(17-15-7-5-6-8-16(15)27-19(17)22-13)25-11-9-14(10-12-25)24(4)20(26)23(2)3/h14H,5-12H2,1-4H3 |
| InChIKey | VZYQOMKHFBUEOJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |