C20H20BrN5O — CID 86946136
1-[1-(6-bromoquinazolin-4-yl)piperidin-4-yl]-3-phenylurea (PubChem CID 86946136) has the molecular formula C20H20BrN5O and a molecular weight of 426.32 g/mol. Its IUPAC name is 1-[1-(6-bromoquinazolin-4-yl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(6-bromoquinazolin-4-yl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 86946136 |
| Molecular Formula | C20H20BrN5O |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-[1-(6-bromoquinazolin-4-yl)piperidin-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1CCN(c2ncnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C20H20BrN5O/c21-14-6-7-18-17(12-14)19(23-13-22-18)26-10-8-16(9-11-26)25-20(27)24-15-4-2-1-3-5-15/h1-7,12-13,16H,8-11H2,(H2,24,25,27) |
| InChIKey | UNXDXFMJOGQOBB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |