C20H18F3N5O — CID 100676372
1-[(3S)-1-[2-(difluoromethyl)quinazolin-4-yl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 100676372) has the molecular formula C20H18F3N5O and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-[(3S)-1-[2-(difluoromethyl)quinazolin-4-yl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3S)-1-[2-(difluoromethyl)quinazolin-4-yl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 100676372 |
| Molecular Formula | C20H18F3N5O |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[(3S)-1-[2-(difluoromethyl)quinazolin-4-yl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N[C@H]1CCN(c2nc(C(F)F)nc3ccccc23)C1 |
| InChI | InChI=1S/C20H18F3N5O/c21-12-5-7-13(8-6-12)24-20(29)25-14-9-10-28(11-14)19-15-3-1-2-4-16(15)26-18(27-19)17(22)23/h1-8,14,17H,9-11H2,(H2,24,25,29)/t14-/m0/s1 |
| InChIKey | CVRDLVXBMFDFRL-AWEZNQCLSA-N |
| XLogP | 4.11 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |