C18H18F2N4O2S2 — CID 56554229
N-[1-[2-(difluoromethyl)quinazolin-4-yl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 56554229) has the molecular formula C18H18F2N4O2S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[1-[2-(difluoromethyl)quinazolin-4-yl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(difluoromethyl)quinazolin-4-yl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56554229 |
| Molecular Formula | C18H18F2N4O2S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[1-[2-(difluoromethyl)quinazolin-4-yl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(c2nc(C(F)F)nc3ccccc23)CC1)c1cccs1 |
| InChI | InChI=1S/C18H18F2N4O2S2/c19-16(20)17-21-14-5-2-1-4-13(14)18(22-17)24-9-7-12(8-10-24)23-28(25,26)15-6-3-11-27-15/h1-6,11-12,16,23H,7-10H2 |
| InChIKey | IQMPACQKOJHBLP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |