C15H16F3N3O3S2 — CID 133489295
N-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 133489295) has the molecular formula C15H16F3N3O3S2 and a molecular weight of 407.44 g/mol. Its IUPAC name is N-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133489295 |
| Molecular Formula | C15H16F3N3O3S2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(c2ccc(OC(F)(F)F)cn2)CC1)c1cccs1 |
| InChI | InChI=1S/C15H16F3N3O3S2/c16-15(17,18)24-12-3-4-13(19-10-12)21-7-5-11(6-8-21)20-26(22,23)14-2-1-9-25-14/h1-4,9-11,20H,5-8H2 |
| InChIKey | JJSKWXGUTBKXIH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |