C12H15F3N2O — CID 133493218
2-(3-ethylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine (PubChem CID 133493218) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(3-ethylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine.
| Compound Name | 2-(3-ethylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 133493218 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(3-ethylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine |
| SMILES | CCC1CCN(c2ccc(OC(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C12H15F3N2O/c1-2-9-5-6-17(8-9)11-4-3-10(7-16-11)18-12(13,14)15/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | XANASNZTXRAPEL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |