C12H16F3N3O2 — CID 133488124
2-[4-[5-(trifluoromethoxy)-2-pyridinyl]piperazin-1-yl]ethanol (PubChem CID 133488124) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[4-[5-(trifluoromethoxy)-2-pyridinyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[5-(trifluoromethoxy)-2-pyridinyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 133488124 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[4-[5-(trifluoromethoxy)-2-pyridinyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2ccc(OC(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)20-10-1-2-11(16-9-10)18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8H2 |
| InChIKey | XDCPABCPPGCDMZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |