C18H18F3N3O2 — CID 121404733
2-[6-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-3-pyridinyl]acetaldehyde (PubChem CID 121404733) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-[6-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-3-pyridinyl]acetaldehyde.
| Compound Name | 2-[6-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-3-pyridinyl]acetaldehyde |
|---|---|
| PubChem CID | 121404733 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[6-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-3-pyridinyl]acetaldehyde |
| SMILES | O=CCc1ccc(N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)nc1 |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)26-16-4-2-15(3-5-16)23-8-10-24(11-9-23)17-6-1-14(7-12-25)13-22-17/h1-6,12-13H,7-11H2 |
| InChIKey | ROPACCZELZKCRW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|