C17H14F6N4O2 — CID 121404786
2-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-(trifluoromethyl)pyrimidine-5-carbaldehyde (PubChem CID 121404786) has the molecular formula C17H14F6N4O2 and a molecular weight of 420.31 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-(trifluoromethyl)pyrimidine-5-carbaldehyde.
| Compound Name | 2-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-(trifluoromethyl)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 121404786 |
| Molecular Formula | C17H14F6N4O2 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-(trifluoromethyl)pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1cnc(N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H14F6N4O2/c18-16(19,20)14-11(10-28)9-24-15(25-14)27-7-5-26(6-8-27)12-1-3-13(4-2-12)29-17(21,22)23/h1-4,9-10H,5-8H2 |
| InChIKey | KAYPUCREYZRLLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|