C20H22F3N3O3 — CID 18285766
4-(4-methoxyphenyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 18285766) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 18285766 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NCc3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-28-17-8-4-16(5-9-17)25-10-12-26(13-11-25)19(27)24-14-15-2-6-18(7-3-15)29-20(21,22)23/h2-9H,10-14H2,1H3,(H,24,27) |
| InChIKey | KITFQMZKFWMRPI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|