C23H32N4O2 — CID 113108225
4-[4-(diethylamino)phenyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 113108225) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-(diethylamino)phenyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108225 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-N-[(4-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)NCc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O2/c1-4-25(5-2)20-8-10-21(11-9-20)26-14-16-27(17-15-26)23(28)24-18-19-6-12-22(29-3)13-7-19/h6-13H,4-5,14-18H2,1-3H3,(H,24,28) |
| InChIKey | DVXADZZGBFQUEH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|