C19H20F3N3O3 — CID 3742709
4-(4-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 3742709) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3742709 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccccc3OC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-27-15-8-6-14(7-9-15)24-10-12-25(13-11-24)18(26)23-16-4-2-3-5-17(16)28-19(20,21)22/h2-9H,10-13H2,1H3,(H,23,26) |
| InChIKey | ZRDDVRGEUPEISA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|