C13H14F7N3O — CID 167756362
1-(2,2,3,3-tetrafluoropropyl)-4-[5-(trifluoromethoxy)-2-pyridinyl]piperazine (PubChem CID 167756362) has the molecular formula C13H14F7N3O and a molecular weight of 361.26 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropyl)-4-[5-(trifluoromethoxy)-2-pyridinyl]piperazine.
| Compound Name | 1-(2,2,3,3-tetrafluoropropyl)-4-[5-(trifluoromethoxy)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 167756362 |
| Molecular Formula | C13H14F7N3O |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropyl)-4-[5-(trifluoromethoxy)-2-pyridinyl]piperazine |
| SMILES | FC(F)C(F)(F)CN1CCN(c2ccc(OC(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H14F7N3O/c14-11(15)12(16,17)8-22-3-5-23(6-4-22)10-2-1-9(7-21-10)24-13(18,19)20/h1-2,7,11H,3-6,8H2 |
| InChIKey | YZOVUFAHKKTMCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|